C8H10N4 — CID 166990353
4,7-dimethylpyrazolo[1,5-a]pyrazin-6-amine (PubChem CID 166990353) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 4,7-dimethylpyrazolo[1,5-a]pyrazin-6-amine.
| Compound Name | 4,7-dimethylpyrazolo[1,5-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 166990353 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 4,7-dimethylpyrazolo[1,5-a]pyrazin-6-amine |
| SMILES | Cc1nc(N)c(C)n2nccc12 |
| InChI | InChI=1S/C8H10N4/c1-5-7-3-4-10-12(7)6(2)8(9)11-5/h3-4H,9H2,1-2H3 |
| InChIKey | CCCLRVWLVSNZLO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |