C26H24N4O5 — CID 68553317
7-oxo-6-[[7-(2-phenylmethoxyethoxy)-1,8,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]methylidene]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 68553317) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 7-oxo-6-[[7-(2-phenylmethoxyethoxy)-1,8,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]methylidene]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | 7-oxo-6-[[7-(2-phenylmethoxyethoxy)-1,8,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]methylidene]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 68553317 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 7-oxo-6-[[7-(2-phenylmethoxyethoxy)-1,8,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]methylidene]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | O=C(O)C1=CCC2C(=Cc3cn4c5c(c(OCCOCc6ccccc6)nc4n3)CCC5)C(=O)N12 |
| InChI | InChI=1S/C26H24N4O5/c31-24-19(21-9-10-22(25(32)33)30(21)24)13-17-14-29-20-8-4-7-18(20)23(28-26(29)27-17)35-12-11-34-15-16-5-2-1-3-6-16/h1-3,5-6,10,13-14,21H,4,7-9,11-12,15H2,(H,32,33) |
| InChIKey | PZCNRROLTHKOKX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|