C23H20F3NO4 — CID 66901592
4-methyl-2-(2-phenylmethoxyethoxy)-6-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid (PubChem CID 66901592) has the molecular formula C23H20F3NO4 and a molecular weight of 431.41 g/mol. Its IUPAC name is 4-methyl-2-(2-phenylmethoxyethoxy)-6-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid.
| Compound Name | 4-methyl-2-(2-phenylmethoxyethoxy)-6-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 66901592 |
| Molecular Formula | C23H20F3NO4 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 4-methyl-2-(2-phenylmethoxyethoxy)-6-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
| SMILES | Cc1cc(-c2cccc(C(F)(F)F)c2)nc(OCCOCc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C23H20F3NO4/c1-15-12-19(17-8-5-9-18(13-17)23(24,25)26)27-21(20(15)22(28)29)31-11-10-30-14-16-6-3-2-4-7-16/h2-9,12-13H,10-11,14H2,1H3,(H,28,29) |
| InChIKey | MCALCNBLENVAOL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|