C18H18IN5O4 — CID 68558085
(1S,3R,4R,7R)-1-(hydroxymethyl)-3-[6-[(3-iodophenyl)methylamino]purin-9-yl]-2,5-dioxabicyclo[2.2.1]heptan-7-ol (PubChem CID 68558085) has the molecular formula C18H18IN5O4 and a molecular weight of 495.28 g/mol. Its IUPAC name is (1S,3R,4R,7R)-1-(hydroxymethyl)-3-[6-[(3-iodophenyl)methylamino]purin-9-yl]-2,5-dioxabicyclo[2.2.1]heptan-7-ol.
| Compound Name | (1S,3R,4R,7R)-1-(hydroxymethyl)-3-[6-[(3-iodophenyl)methylamino]purin-9-yl]-2,5-dioxabicyclo[2.2.1]heptan-7-ol |
|---|---|
| PubChem CID | 68558085 |
| Molecular Formula | C18H18IN5O4 |
| Molecular Weight | 495.28 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | (1S,3R,4R,7R)-1-(hydroxymethyl)-3-[6-[(3-iodophenyl)methylamino]purin-9-yl]-2,5-dioxabicyclo[2.2.1]heptan-7-ol |
| SMILES | OC[C@@]12CO[C@@H]([C@H](n3cnc4c(NCc5cccc(I)c5)ncnc43)O1)[C@H]2O |
| InChI | InChI=1S/C18H18IN5O4/c19-11-3-1-2-10(4-11)5-20-15-12-16(22-8-21-15)24(9-23-12)17-13-14(26)18(6-25,28-17)7-27-13/h1-4,8-9,13-14,17,25-26H,5-7H2,(H,20,21,22)/t13-,14-,17-,18+/m1/s1 |
| InChIKey | HDNRZMZGFPIXML-DTDBQYNISA-N |
| XLogP | 1.06 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|