C30H32N2O4 — CID 68560913
1-cyclohex-3-en-1-ylindole-6-carboxylic acid;3-cyclohexyl-1H-indole-6-carboxylic acid (PubChem CID 68560913) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-ylindole-6-carboxylic acid;3-cyclohexyl-1H-indole-6-carboxylic acid.
| Compound Name | 1-cyclohex-3-en-1-ylindole-6-carboxylic acid;3-cyclohexyl-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 68560913 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 1-cyclohex-3-en-1-ylindole-6-carboxylic acid;3-cyclohexyl-1H-indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c[nH]c2c1.O=C(O)c1ccc2ccn(C3CC=CCC3)c2c1 |
| InChI | InChI=1S/C15H17NO2.C15H15NO2/c17-15(18)11-6-7-12-13(9-16-14(12)8-11)10-4-2-1-3-5-10;17-15(18)12-7-6-11-8-9-16(14(11)10-12)13-4-2-1-3-5-13/h6-10,16H,1-5H2,(H,17,18);1-2,6-10,13H,3-5H2,(H,17,18) |
| InChIKey | DPAPMWYNUYLZPK-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|