C21H23N3O3 — CID 157341268
1-cyclohexylindole-5-carboxylic acid;pyridine-3-carboxamide (PubChem CID 157341268) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-cyclohexylindole-5-carboxylic acid;pyridine-3-carboxamide.
| Compound Name | 1-cyclohexylindole-5-carboxylic acid;pyridine-3-carboxamide |
|---|---|
| PubChem CID | 157341268 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-cyclohexylindole-5-carboxylic acid;pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1.O=C(O)c1ccc2c(ccn2C2CCCCC2)c1 |
| InChI | InChI=1S/C15H17NO2.C6H6N2O/c17-15(18)12-6-7-14-11(10-12)8-9-16(14)13-4-2-1-3-5-13;7-6(9)5-2-1-3-8-4-5/h6-10,13H,1-5H2,(H,17,18);1-4H,(H2,7,9) |
| InChIKey | BGKRIHXZHSLFQQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |