C22H23FN2O2S — CID 68562053
N-(1,3-benzothiazol-6-yl)-2-[2-fluoro-3-[(E)-hept-3-enoxy]phenyl]acetamide (PubChem CID 68562053) has the molecular formula C22H23FN2O2S and a molecular weight of 398.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-2-[2-fluoro-3-[(E)-hept-3-enoxy]phenyl]acetamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-2-[2-fluoro-3-[(E)-hept-3-enoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 68562053 |
| Molecular Formula | C22H23FN2O2S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-2-[2-fluoro-3-[(E)-hept-3-enoxy]phenyl]acetamide |
| SMILES | CCC/C=C/CCOc1cccc(CC(=O)Nc2ccc3ncsc3c2)c1F |
| InChI | InChI=1S/C22H23FN2O2S/c1-2-3-4-5-6-12-27-19-9-7-8-16(22(19)23)13-21(26)25-17-10-11-18-20(14-17)28-15-24-18/h4-5,7-11,14-15H,2-3,6,12-13H2,1H3,(H,25,26)/b5-4+ |
| InChIKey | MPEUGSDXTMIGHT-SNAWJCMRSA-N |
| XLogP | 5.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|