C21H20N2O2S — CID 91389846
N-(1,3-benzothiazol-6-yl)-2-(3-hex-2-ynoxyphenyl)acetamide (PubChem CID 91389846) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-2-(3-hex-2-ynoxyphenyl)acetamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-2-(3-hex-2-ynoxyphenyl)acetamide |
|---|---|
| PubChem CID | 91389846 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-2-(3-hex-2-ynoxyphenyl)acetamide |
| SMILES | CCCC#CCOc1cccc(CC(=O)Nc2ccc3ncsc3c2)c1 |
| InChI | InChI=1S/C21H20N2O2S/c1-2-3-4-5-11-25-18-8-6-7-16(12-18)13-21(24)23-17-9-10-19-20(14-17)26-15-22-19/h6-10,12,14-15H,2-3,11,13H2,1H3,(H,23,24) |
| InChIKey | RGCKZEQEIOJSSU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|