C21H25FN2O2SSi — CID 68558974
N-(1,3-benzothiazol-6-yl)-2-[3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]acetamide (PubChem CID 68558974) has the molecular formula C21H25FN2O2SSi and a molecular weight of 416.59 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-2-[3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]acetamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-2-[3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 68558974 |
| Molecular Formula | C21H25FN2O2SSi |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-2-[3-[tert-butyl(dimethyl)silyl]oxy-2-fluorophenyl]acetamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc(CC(=O)Nc2ccc3ncsc3c2)c1F |
| InChI | InChI=1S/C21H25FN2O2SSi/c1-21(2,3)28(4,5)26-17-8-6-7-14(20(17)22)11-19(25)24-15-9-10-16-18(12-15)27-13-23-16/h6-10,12-13H,11H2,1-5H3,(H,24,25) |
| InChIKey | TXPAZPBUMADDBA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|