C21H20INO — CID 68562302
5-iodo-2-methyl-N-(2-naphthalen-1-ylpropyl)benzamide (PubChem CID 68562302) has the molecular formula C21H20INO and a molecular weight of 429.30 g/mol. Its IUPAC name is 5-iodo-2-methyl-N-(2-naphthalen-1-ylpropyl)benzamide.
| Compound Name | 5-iodo-2-methyl-N-(2-naphthalen-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 68562302 |
| Molecular Formula | C21H20INO |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 5-iodo-2-methyl-N-(2-naphthalen-1-ylpropyl)benzamide |
| SMILES | Cc1ccc(I)cc1C(=O)NCC(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H20INO/c1-14-10-11-17(22)12-20(14)21(24)23-13-15(2)18-9-5-7-16-6-3-4-8-19(16)18/h3-12,15H,13H2,1-2H3,(H,23,24) |
| InChIKey | XOZXJGLBNJQZGZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|