C21H27N3OS — CID 68565508
[(2S,3aS,6aS)-2-(aminomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[5-(3,4-dimethylphenyl)-2-methyl-1,3-thiazol-4-yl]methanone (PubChem CID 68565508) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is [(2S,3aS,6aS)-2-(aminomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[5-(3,4-dimethylphenyl)-2-methyl-1,3-thiazol-4-yl]methanone.
| Compound Name | [(2S,3aS,6aS)-2-(aminomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[5-(3,4-dimethylphenyl)-2-methyl-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 68565508 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [(2S,3aS,6aS)-2-(aminomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[5-(3,4-dimethylphenyl)-2-methyl-1,3-thiazol-4-yl]methanone |
| SMILES | Cc1nc(C(=O)N2[C@H](CN)C[C@@H]3CCC[C@@H]32)c(-c2ccc(C)c(C)c2)s1 |
| InChI | InChI=1S/C21H27N3OS/c1-12-7-8-16(9-13(12)2)20-19(23-14(3)26-20)21(25)24-17(11-22)10-15-5-4-6-18(15)24/h7-9,15,17-18H,4-6,10-11,22H2,1-3H3/t15-,17-,18-/m0/s1 |
| InChIKey | DEODLGXLJHXHSK-SZMVWBNQSA-N |
| XLogP | 4.08 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |