C19H24N4OS — CID 89043800
[(2S,3aS,6aS)-2-(aminomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[2-amino-5-(4-methylphenyl)-1,3-thiazol-4-yl]methanone (PubChem CID 89043800) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is [(2S,3aS,6aS)-2-(aminomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[2-amino-5-(4-methylphenyl)-1,3-thiazol-4-yl]methanone.
| Compound Name | [(2S,3aS,6aS)-2-(aminomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[2-amino-5-(4-methylphenyl)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 89043800 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [(2S,3aS,6aS)-2-(aminomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]-[2-amino-5-(4-methylphenyl)-1,3-thiazol-4-yl]methanone |
| SMILES | Cc1ccc(-c2sc(N)nc2C(=O)N2[C@H](CN)C[C@@H]3CCC[C@@H]32)cc1 |
| InChI | InChI=1S/C19H24N4OS/c1-11-5-7-12(8-6-11)17-16(22-19(21)25-17)18(24)23-14(10-20)9-13-3-2-4-15(13)23/h5-8,13-15H,2-4,9-10,20H2,1H3,(H2,21,22)/t13-,14-,15-/m0/s1 |
| InChIKey | ALHDZFCAPBJRLC-KKUMJFAQSA-N |
| XLogP | 3.04 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |