C18H17NO — CID 68565618
11-ethyl-2-methoxy-6H-isoindolo[2,1-a]indole (PubChem CID 68565618) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 11-ethyl-2-methoxy-6H-isoindolo[2,1-a]indole.
| Compound Name | 11-ethyl-2-methoxy-6H-isoindolo[2,1-a]indole |
|---|---|
| PubChem CID | 68565618 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 11-ethyl-2-methoxy-6H-isoindolo[2,1-a]indole |
| SMILES | CCc1c2n(c3ccc(OC)cc13)Cc1ccccc1-2 |
| InChI | InChI=1S/C18H17NO/c1-3-14-16-10-13(20-2)8-9-17(16)19-11-12-6-4-5-7-15(12)18(14)19/h4-10H,3,11H2,1-2H3 |
| InChIKey | NWKMLEHXNCFOEA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |