C26H25F3N2O4 — CID 68569350
(4R,5S)-2-[(2,5-dimethoxyphenyl)methyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid (PubChem CID 68569350) has the molecular formula C26H25F3N2O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is (4R,5S)-2-[(2,5-dimethoxyphenyl)methyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid.
| Compound Name | (4R,5S)-2-[(2,5-dimethoxyphenyl)methyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68569350 |
| Molecular Formula | C26H25F3N2O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (4R,5S)-2-[(2,5-dimethoxyphenyl)methyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(OC)c(CC2=N[C@H](c3ccccc3)[C@H](c3ccccc3)N2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H24N2O2.C2HF3O2/c1-27-20-13-14-21(28-2)19(15-20)16-22-25-23(17-9-5-3-6-10-17)24(26-22)18-11-7-4-8-12-18;3-2(4,5)1(6)7/h3-15,23-24H,16H2,1-2H3,(H,25,26);(H,6,7)/t23-,24+; |
| InChIKey | HWRHCGFIHWFUEA-HQPOOZHGSA-N |
| XLogP | 5.36 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |