C27H27F3N2O4 — CID 68568413
(4R,5S)-2-[2-(3,4-dimethoxyphenyl)ethyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid (PubChem CID 68568413) has the molecular formula C27H27F3N2O4 and a molecular weight of 500.52 g/mol. Its IUPAC name is (4R,5S)-2-[2-(3,4-dimethoxyphenyl)ethyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid.
| Compound Name | (4R,5S)-2-[2-(3,4-dimethoxyphenyl)ethyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68568413 |
| Molecular Formula | C27H27F3N2O4 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | (4R,5S)-2-[2-(3,4-dimethoxyphenyl)ethyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CCC2=N[C@H](c3ccccc3)[C@H](c3ccccc3)N2)cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H26N2O2.C2HF3O2/c1-28-21-15-13-18(17-22(21)29-2)14-16-23-26-24(19-9-5-3-6-10-19)25(27-23)20-11-7-4-8-12-20;3-2(4,5)1(6)7/h3-13,15,17,24-25H,14,16H2,1-2H3,(H,26,27);(H,6,7)/t24-,25+; |
| InChIKey | FEBZQPGIKOGHRY-GMFOKBBGSA-N |
| XLogP | 5.75 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |