C18H20N2 — CID 143001545
(4R)-5-methyl-4-phenyl-2-(2-phenylethyl)-4,5-dihydro-1H-imidazole (PubChem CID 143001545) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (4R)-5-methyl-4-phenyl-2-(2-phenylethyl)-4,5-dihydro-1H-imidazole.
| Compound Name | (4R)-5-methyl-4-phenyl-2-(2-phenylethyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 143001545 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (4R)-5-methyl-4-phenyl-2-(2-phenylethyl)-4,5-dihydro-1H-imidazole |
| SMILES | CC1NC(CCc2ccccc2)=N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20N2/c1-14-18(16-10-6-3-7-11-16)20-17(19-14)13-12-15-8-4-2-5-9-15/h2-11,14,18H,12-13H2,1H3,(H,19,20)/t14?,18-/m0/s1 |
| InChIKey | XJNZQPAYGNXKHR-IBYPIGCZSA-N |
| XLogP | 3.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |