C24H35N3O2 — CID 68575022
tert-butyl 4-[isoquinolin-1-ylmethyl(2-methylpropyl)amino]piperidine-1-carboxylate (PubChem CID 68575022) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is tert-butyl 4-[isoquinolin-1-ylmethyl(2-methylpropyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[isoquinolin-1-ylmethyl(2-methylpropyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68575022 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | tert-butyl 4-[isoquinolin-1-ylmethyl(2-methylpropyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)CN(Cc1nccc2ccccc12)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H35N3O2/c1-18(2)16-27(17-22-21-9-7-6-8-19(21)10-13-25-22)20-11-14-26(15-12-20)23(28)29-24(3,4)5/h6-10,13,18,20H,11-12,14-17H2,1-5H3 |
| InChIKey | IQQRXTNHNUUDOA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |