C15H11NO2S — CID 68588266
3-[2-(4-hydroxyphenyl)ethenyl]-1,3-benzothiazol-2-one (PubChem CID 68588266) has the molecular formula C15H11NO2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 3-[2-(4-hydroxyphenyl)ethenyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-[2-(4-hydroxyphenyl)ethenyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 68588266 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-[2-(4-hydroxyphenyl)ethenyl]-1,3-benzothiazol-2-one |
| SMILES | O=c1sc2ccccc2n1C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C15H11NO2S/c17-12-7-5-11(6-8-12)9-10-16-13-3-1-2-4-14(13)19-15(16)18/h1-10,17H |
| InChIKey | ARLYABDYNYSBDB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |