C19H17N5 — CID 6858841
(E)-1-[1-[(2-methylphenyl)methyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 6858841) has the molecular formula C19H17N5 and a molecular weight of 315.38 g/mol. Its IUPAC name is (E)-1-[1-[(2-methylphenyl)methyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-[1-[(2-methylphenyl)methyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6858841 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (E)-1-[1-[(2-methylphenyl)methyl]indol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1ccccc1Cn1cc(/C=N/n2cnnc2)c2ccccc21 |
| InChI | InChI=1S/C19H17N5/c1-15-6-2-3-7-16(15)11-23-12-17(10-22-24-13-20-21-14-24)18-8-4-5-9-19(18)23/h2-10,12-14H,11H2,1H3/b22-10+ |
| InChIKey | KULYUUFYCHGOON-LSHDLFTRSA-N |
| XLogP | 3.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|