C19H22ClFN2O — CID 68589190
N'-[4-(4-chloro-3-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide (PubChem CID 68589190) has the molecular formula C19H22ClFN2O and a molecular weight of 348.85 g/mol. Its IUPAC name is N'-[4-(4-chloro-3-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide.
| Compound Name | N'-[4-(4-chloro-3-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide |
|---|---|
| PubChem CID | 68589190 |
| Molecular Formula | C19H22ClFN2O |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N'-[4-(4-chloro-3-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide |
| SMILES | CCN(/C=N/c1cc(C)c(Oc2ccc(Cl)c(F)c2)cc1C)CC |
| InChI | InChI=1S/C19H22ClFN2O/c1-5-23(6-2)12-22-18-9-14(4)19(10-13(18)3)24-15-7-8-16(20)17(21)11-15/h7-12H,5-6H2,1-4H3/b22-12+ |
| InChIKey | INASRPYPWMEUGP-WSDLNYQXSA-N |
| XLogP | 5.89 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|