C21H24IN3O3 — CID 68591450
ethyl 2-[(4-iodo-3-methylphenyl)carbamoyl]-1-pyridin-2-ylpiperidine-4-carboxylate (PubChem CID 68591450) has the molecular formula C21H24IN3O3 and a molecular weight of 493.35 g/mol. Its IUPAC name is ethyl 2-[(4-iodo-3-methylphenyl)carbamoyl]-1-pyridin-2-ylpiperidine-4-carboxylate.
| Compound Name | ethyl 2-[(4-iodo-3-methylphenyl)carbamoyl]-1-pyridin-2-ylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 68591450 |
| Molecular Formula | C21H24IN3O3 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | ethyl 2-[(4-iodo-3-methylphenyl)carbamoyl]-1-pyridin-2-ylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccccn2)C(C(=O)Nc2ccc(I)c(C)c2)C1 |
| InChI | InChI=1S/C21H24IN3O3/c1-3-28-21(27)15-9-11-25(19-6-4-5-10-23-19)18(13-15)20(26)24-16-7-8-17(22)14(2)12-16/h4-8,10,12,15,18H,3,9,11,13H2,1-2H3,(H,24,26) |
| InChIKey | XJHFEIUZCMKLQK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|