C16H13F2NO3 — CID 68591612
2-(4-cyclopent-2-en-1-yl-6,7-difluoro-1-oxoisoquinolin-2-yl)acetic acid (PubChem CID 68591612) has the molecular formula C16H13F2NO3 and a molecular weight of 305.28 g/mol. Its IUPAC name is 2-(4-cyclopent-2-en-1-yl-6,7-difluoro-1-oxoisoquinolin-2-yl)acetic acid.
| Compound Name | 2-(4-cyclopent-2-en-1-yl-6,7-difluoro-1-oxoisoquinolin-2-yl)acetic acid |
|---|---|
| PubChem CID | 68591612 |
| Molecular Formula | C16H13F2NO3 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-(4-cyclopent-2-en-1-yl-6,7-difluoro-1-oxoisoquinolin-2-yl)acetic acid |
| SMILES | O=C(O)Cn1cc(C2C=CCC2)c2cc(F)c(F)cc2c1=O |
| InChI | InChI=1S/C16H13F2NO3/c17-13-5-10-11(6-14(13)18)16(22)19(8-15(20)21)7-12(10)9-3-1-2-4-9/h1,3,5-7,9H,2,4,8H2,(H,20,21) |
| InChIKey | GBMIKAXESMWJGV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|