C10H16N2O2S — CID 686023
(3S,8aS)-3,7,7,8a-tetramethyl-5-sulfanylidene-6,8-dihydro-3H-[1,3]oxazolo[3,2-c]pyrimidin-2-one (PubChem CID 686023) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is (3S,8aS)-3,7,7,8a-tetramethyl-5-sulfanylidene-6,8-dihydro-3H-[1,3]oxazolo[3,2-c]pyrimidin-2-one.
| Compound Name | (3S,8aS)-3,7,7,8a-tetramethyl-5-sulfanylidene-6,8-dihydro-3H-[1,3]oxazolo[3,2-c]pyrimidin-2-one |
|---|---|
| PubChem CID | 686023 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | (3S,8aS)-3,7,7,8a-tetramethyl-5-sulfanylidene-6,8-dihydro-3H-[1,3]oxazolo[3,2-c]pyrimidin-2-one |
| SMILES | C[C@H]1C(=O)O[C@@]2(C)CC(C)(C)NC(=S)N12 |
| InChI | InChI=1S/C10H16N2O2S/c1-6-7(13)14-10(4)5-9(2,3)11-8(15)12(6)10/h6H,5H2,1-4H3,(H,11,15)/t6-,10-/m0/s1 |
| InChIKey | VKMXVOKRYFRRQV-WKEGUHRASA-N |
| XLogP | 1.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|