C9H16N4OS — CID 7353183
(9aR)-8,8,9a-trimethyl-6-sulfanylidene-2,4,7,9-tetrahydro-1H-pyrimido[6,1-c][1,2,4]triazin-3-one (PubChem CID 7353183) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is (9aR)-8,8,9a-trimethyl-6-sulfanylidene-2,4,7,9-tetrahydro-1H-pyrimido[6,1-c][1,2,4]triazin-3-one.
| Compound Name | (9aR)-8,8,9a-trimethyl-6-sulfanylidene-2,4,7,9-tetrahydro-1H-pyrimido[6,1-c][1,2,4]triazin-3-one |
|---|---|
| PubChem CID | 7353183 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (9aR)-8,8,9a-trimethyl-6-sulfanylidene-2,4,7,9-tetrahydro-1H-pyrimido[6,1-c][1,2,4]triazin-3-one |
| SMILES | CC1(C)C[C@@]2(C)NNC(=O)CN2C(=S)N1 |
| InChI | InChI=1S/C9H16N4OS/c1-8(2)5-9(3)12-11-6(14)4-13(9)7(15)10-8/h12H,4-5H2,1-3H3,(H,10,15)(H,11,14)/t9-/m0/s1 |
| InChIKey | LMFNGKNBVRKSAM-VIFPVBQESA-N |
| XLogP | -0.30 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|