C14H19N3S — CID 10332895
3,3,4a,7-tetramethyl-4,5-dihydro-2H-pyrimido[1,6-a]benzimidazole-1-thione (PubChem CID 10332895) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 3,3,4a,7-tetramethyl-4,5-dihydro-2H-pyrimido[1,6-a]benzimidazole-1-thione.
| Compound Name | 3,3,4a,7-tetramethyl-4,5-dihydro-2H-pyrimido[1,6-a]benzimidazole-1-thione |
|---|---|
| PubChem CID | 10332895 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3,3,4a,7-tetramethyl-4,5-dihydro-2H-pyrimido[1,6-a]benzimidazole-1-thione |
| SMILES | Cc1ccc2c(c1)NC1(C)CC(C)(C)NC(=S)N21 |
| InChI | InChI=1S/C14H19N3S/c1-9-5-6-11-10(7-9)15-14(4)8-13(2,3)16-12(18)17(11)14/h5-7,15H,8H2,1-4H3,(H,16,18) |
| InChIKey | APFZTKMRJFGCOS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|