C10H13N3O — CID 142044800
1-amino-7-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one (PubChem CID 142044800) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-amino-7-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one.
| Compound Name | 1-amino-7-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 142044800 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-amino-7-methyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one |
| SMILES | Cc1ccc2c(c1)NC(=O)CCN2N |
| InChI | InChI=1S/C10H13N3O/c1-7-2-3-9-8(6-7)12-10(14)4-5-13(9)11/h2-3,6H,4-5,11H2,1H3,(H,12,14) |
| InChIKey | PKLHEFDSRRKPRG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|