C13H17N3O2S — CID 68603545
ethyl 3-[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoate (PubChem CID 68603545) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is ethyl 3-[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoate.
| Compound Name | ethyl 3-[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 68603545 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | ethyl 3-[(5-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoate |
| SMILES | CCOC(=O)CC(C)Nc1ncnc2scc(C)c12 |
| InChI | InChI=1S/C13H17N3O2S/c1-4-18-10(17)5-9(3)16-12-11-8(2)6-19-13(11)15-7-14-12/h6-7,9H,4-5H2,1-3H3,(H,14,15,16) |
| InChIKey | UDVZGEUEWLQURN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |