C19H25N3O2S — CID 68604895
N-(1,4-dibenzylpiperazin-2-yl)methanesulfonamide (PubChem CID 68604895) has the molecular formula C19H25N3O2S and a molecular weight of 359.49 g/mol. Its IUPAC name is N-(1,4-dibenzylpiperazin-2-yl)methanesulfonamide.
| Compound Name | N-(1,4-dibenzylpiperazin-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 68604895 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-(1,4-dibenzylpiperazin-2-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CN(Cc2ccccc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H25N3O2S/c1-25(23,24)20-19-16-21(14-17-8-4-2-5-9-17)12-13-22(19)15-18-10-6-3-7-11-18/h2-11,19-20H,12-16H2,1H3 |
| InChIKey | HVEKDQDGWCPVGZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |