C32H41N3O4 — CID 68610237
2-[(2S,3R)-3-hydroxy-4-(2-phenoxyethylamino)-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68610237) has the molecular formula C32H41N3O4 and a molecular weight of 531.70 g/mol. Its IUPAC name is 2-[(2S,3R)-3-hydroxy-4-(2-phenoxyethylamino)-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 2-[(2S,3R)-3-hydroxy-4-(2-phenoxyethylamino)-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68610237 |
| Molecular Formula | C32H41N3O4 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | 2-[(2S,3R)-3-hydroxy-4-(2-phenoxyethylamino)-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(N)=O)c1[C@H](Cc1ccccc1)[C@@H](O)CNCCOc1ccccc1 |
| InChI | InChI=1S/C32H41N3O4/c1-3-19-35(20-4-2)32(38)27-17-11-16-26(31(33)37)30(27)28(22-24-12-7-5-8-13-24)29(36)23-34-18-21-39-25-14-9-6-10-15-25/h5-17,28-29,34,36H,3-4,18-23H2,1-2H3,(H2,33,37)/t28-,29+/m1/s1 |
| InChIKey | XDWLVMSQKNOONC-WDYNHAJCSA-N |
| XLogP | 4.40 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|