C31H37Cl2N3O3 — CID 70143527
2-[(2S,3R)-4-[(3,5-dichlorophenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 70143527) has the molecular formula C31H37Cl2N3O3 and a molecular weight of 570.56 g/mol. Its IUPAC name is 2-[(2S,3R)-4-[(3,5-dichlorophenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 2-[(2S,3R)-4-[(3,5-dichlorophenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 70143527 |
| Molecular Formula | C31H37Cl2N3O3 |
| Molecular Weight | 570.56 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 2-[(2S,3R)-4-[(3,5-dichlorophenyl)methylamino]-3-hydroxy-1-phenylbutan-2-yl]-1-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCNC(=O)c1cccc(C(=O)NCCC)c1[C@H](Cc1ccccc1)[C@@H](O)CNCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C31H37Cl2N3O3/c1-3-13-35-30(38)25-11-8-12-26(31(39)36-14-4-2)29(25)27(17-21-9-6-5-7-10-21)28(37)20-34-19-22-15-23(32)18-24(33)16-22/h5-12,15-16,18,27-28,34,37H,3-4,13-14,17,19-20H2,1-2H3,(H,35,38)(H,36,39)/t27-,28+/m1/s1 |
| InChIKey | BHTJGDCYUPIIRK-IZLXSDGUSA-N |
| XLogP | 5.75 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |