C22H13F3N4O5 — CID 68621511
6-[4-[[4-nitro-3-(trifluoromethyl)benzoyl]amino]phenyl]-1H-indazole-3-carboxylic acid (PubChem CID 68621511) has the molecular formula C22H13F3N4O5 and a molecular weight of 470.36 g/mol. Its IUPAC name is 6-[4-[[4-nitro-3-(trifluoromethyl)benzoyl]amino]phenyl]-1H-indazole-3-carboxylic acid.
| Compound Name | 6-[4-[[4-nitro-3-(trifluoromethyl)benzoyl]amino]phenyl]-1H-indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 68621511 |
| Molecular Formula | C22H13F3N4O5 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 6-[4-[[4-nitro-3-(trifluoromethyl)benzoyl]amino]phenyl]-1H-indazole-3-carboxylic acid |
| SMILES | O=C(Nc1ccc(-c2ccc3c(C(=O)O)n[nH]c3c2)cc1)c1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H13F3N4O5/c23-22(24,25)16-9-13(4-8-18(16)29(33)34)20(30)26-14-5-1-11(2-6-14)12-3-7-15-17(10-12)27-28-19(15)21(31)32/h1-10H,(H,26,30)(H,27,28)(H,31,32) |
| InChIKey | CQHVHOHZISYCAX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|