About (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine
(1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 68634677) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine.
Analyze (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine?
The IUPAC name of (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine (CID 68634677) is (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine is CC[C@@]1(N(C)C)C=CC=CC1.
What is the InChIKey of (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine?
The InChIKey is STHCIJVUBRRPNO-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H17N/c1-4-10(11(2)3)8-6-5-7-9-10/h5-8H,4,9H2,1-3H3/t10-/m1/s1.
What are the key properties of (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine?
(1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine has a molecular weight of 151.25 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 68634677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).