C10H17N — CID 68634677
(1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine (PubChem CID 68634677) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine.
| Compound Name | (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 68634677 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (1S)-1-ethyl-N,N-dimethylcyclohexa-2,4-dien-1-amine |
| SMILES | CC[C@@]1(CC=CC=C1)N(C)C |
| InChI | InChI=1S/C10H17N/c1-4-10(11(2)3)8-6-5-7-9-10/h5-8H,4,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | STHCIJVUBRRPNO-SNVBAGLBSA-N |
| XLogP | 2.50 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | 179 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |