C11H20ClN — CID 68622736
(1-ethylcyclohexa-2,4-dien-1-yl)-trimethylazanium chloride (PubChem CID 68622736) has the molecular formula C11H20ClN and a molecular weight of 201.74 g/mol. Its IUPAC name is (1-ethylcyclohexa-2,4-dien-1-yl)-trimethylazanium chloride.
| Compound Name | (1-ethylcyclohexa-2,4-dien-1-yl)-trimethylazanium chloride |
|---|---|
| PubChem CID | 68622736 |
| Molecular Formula | C11H20ClN |
| Molecular Weight | 201.74 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | (1-ethylcyclohexa-2,4-dien-1-yl)-trimethylazanium chloride |
| SMILES | CCC1([N+](C)(C)C)C=CC=CC1.[Cl-] |
| InChI | InChI=1S/C11H20N.ClH/c1-5-11(12(2,3)4)9-7-6-8-10-11;/h6-9H,5,10H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FSXWJBFXWJEHAA-UHFFFAOYSA-M |
| XLogP | -0.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.74 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|