C23H22IN3O2 — CID 68634848
2-[(1S)-1-[2-[[ethyl(methyl)amino]methyl]-7-iodoquinolin-3-yl]ethyl]isoindole-1,3-dione (PubChem CID 68634848) has the molecular formula C23H22IN3O2 and a molecular weight of 499.35 g/mol. Its IUPAC name is 2-[(1S)-1-[2-[[ethyl(methyl)amino]methyl]-7-iodoquinolin-3-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S)-1-[2-[[ethyl(methyl)amino]methyl]-7-iodoquinolin-3-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 68634848 |
| Molecular Formula | C23H22IN3O2 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 2-[(1S)-1-[2-[[ethyl(methyl)amino]methyl]-7-iodoquinolin-3-yl]ethyl]isoindole-1,3-dione |
| SMILES | CCN(C)Cc1nc2cc(I)ccc2cc1[C@H](C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H22IN3O2/c1-4-26(3)13-21-19(11-15-9-10-16(24)12-20(15)25-21)14(2)27-22(28)17-7-5-6-8-18(17)23(27)29/h5-12,14H,4,13H2,1-3H3/t14-/m0/s1 |
| InChIKey | FWAOPNWCHNWPHA-AWEZNQCLSA-N |
| XLogP | 4.65 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|