C18H19BrN2O5S — CID 68635999
(E)-N-[1-(4-bromophenyl)sulfonylpyrrol-3-yl]-3-(oxan-2-yloxy)prop-2-enamide (PubChem CID 68635999) has the molecular formula C18H19BrN2O5S and a molecular weight of 455.33 g/mol. Its IUPAC name is (E)-N-[1-(4-bromophenyl)sulfonylpyrrol-3-yl]-3-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-N-[1-(4-bromophenyl)sulfonylpyrrol-3-yl]-3-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 68635999 |
| Molecular Formula | C18H19BrN2O5S |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | (E)-N-[1-(4-bromophenyl)sulfonylpyrrol-3-yl]-3-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(/C=C/OC1CCCCO1)Nc1ccn(S(=O)(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C18H19BrN2O5S/c19-14-4-6-16(7-5-14)27(23,24)21-10-8-15(13-21)20-17(22)9-12-26-18-3-1-2-11-25-18/h4-10,12-13,18H,1-3,11H2,(H,20,22)/b12-9+ |
| InChIKey | CEKPQDXGFGNEDP-FMIVXFBMSA-N |
| XLogP | 3.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|