C25H41NO4 — CID 68637171
1-[(3aS,4S,7S,7aR)-2,2-dimethyl-4-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]decan-1-amine (PubChem CID 68637171) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is 1-[(3aS,4S,7S,7aR)-2,2-dimethyl-4-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]decan-1-amine.
| Compound Name | 1-[(3aS,4S,7S,7aR)-2,2-dimethyl-4-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]decan-1-amine |
|---|---|
| PubChem CID | 68637171 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | 1-[(3aS,4S,7S,7aR)-2,2-dimethyl-4-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]decan-1-amine |
| SMILES | CCCCCCCCCC(N)[C@H]1CO[C@@H](OCc2ccccc2)[C@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C25H41NO4/c1-4-5-6-7-8-9-13-16-21(26)20-18-28-24(23-22(20)29-25(2,3)30-23)27-17-19-14-11-10-12-15-19/h10-12,14-15,20-24H,4-9,13,16-18,26H2,1-3H3/t20-,21?,22-,23+,24-/m1/s1 |
| InChIKey | VOQRAJAFGQOAPL-DTLGGHNDSA-N |
| XLogP | 5.16 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|