C41H40O7 — CID 68637472
[4-[2-[4-(4-ethyl-2-methoxyphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] [4-(2-phenylpropan-2-yl)phenyl] carbonate (PubChem CID 68637472) has the molecular formula C41H40O7 and a molecular weight of 644.76 g/mol. Its IUPAC name is [4-[2-[4-(4-ethyl-2-methoxyphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] [4-(2-phenylpropan-2-yl)phenyl] carbonate.
| Compound Name | [4-[2-[4-(4-ethyl-2-methoxyphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] [4-(2-phenylpropan-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 68637472 |
| Molecular Formula | C41H40O7 |
| Molecular Weight | 644.76 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | [4-[2-[4-(4-ethyl-2-methoxyphenoxy)carbonyloxyphenyl]propan-2-yl]phenyl] [4-(2-phenylpropan-2-yl)phenyl] carbonate |
| SMILES | CCc1ccc(OC(=O)Oc2ccc(C(C)(C)c3ccc(OC(=O)Oc4ccc(C(C)(C)c5ccccc5)cc4)cc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C41H40O7/c1-7-28-13-26-36(37(27-28)44-6)48-39(43)47-35-24-18-32(19-25-35)41(4,5)31-16-22-34(23-17-31)46-38(42)45-33-20-14-30(15-21-33)40(2,3)29-11-9-8-10-12-29/h8-27H,7H2,1-6H3 |
| InChIKey | MZUXYRSWHDWTBM-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.76 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|