C33H34O5 — CID 141468307
bis[4-(1-methoxy-2-phenylpropan-2-yl)phenyl] carbonate (PubChem CID 141468307) has the molecular formula C33H34O5 and a molecular weight of 510.63 g/mol. Its IUPAC name is bis[4-(1-methoxy-2-phenylpropan-2-yl)phenyl] carbonate.
| Compound Name | bis[4-(1-methoxy-2-phenylpropan-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 141468307 |
| Molecular Formula | C33H34O5 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | bis[4-(1-methoxy-2-phenylpropan-2-yl)phenyl] carbonate |
| SMILES | COCC(C)(c1ccccc1)c1ccc(OC(=O)Oc2ccc(C(C)(COC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H34O5/c1-32(23-35-3,25-11-7-5-8-12-25)27-15-19-29(20-16-27)37-31(34)38-30-21-17-28(18-22-30)33(2,24-36-4)26-13-9-6-10-14-26/h5-22H,23-24H2,1-4H3 |
| InChIKey | BKNFSLKRPVXJPP-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|