C20H25N3O4 — CID 68637846
6-[4-[(Z)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]hexanoic acid (PubChem CID 68637846) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 6-[4-[(Z)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]hexanoic acid.
| Compound Name | 6-[4-[(Z)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 68637846 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 6-[4-[(Z)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoyl]piperazin-1-yl]hexanoic acid |
| SMILES | N#C/C(=C/c1ccc(O)cc1)C(=O)N1CCN(CCCCCC(=O)O)CC1 |
| InChI | InChI=1S/C20H25N3O4/c21-15-17(14-16-5-7-18(24)8-6-16)20(27)23-12-10-22(11-13-23)9-3-1-2-4-19(25)26/h5-8,14,24H,1-4,9-13H2,(H,25,26)/b17-14- |
| InChIKey | WRANVJRSLUMDLS-VKAVYKQESA-N |
| XLogP | 2.09 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|