C18H18O2S — CID 68643135
2-[(3-methoxyphenyl)methylidene]-5-thiophen-2-ylcyclohexan-1-one (PubChem CID 68643135) has the molecular formula C18H18O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methylidene]-5-thiophen-2-ylcyclohexan-1-one.
| Compound Name | 2-[(3-methoxyphenyl)methylidene]-5-thiophen-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 68643135 |
| Molecular Formula | C18H18O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-[(3-methoxyphenyl)methylidene]-5-thiophen-2-ylcyclohexan-1-one |
| SMILES | COc1cccc(C=C2CCC(c3cccs3)CC2=O)c1 |
| InChI | InChI=1S/C18H18O2S/c1-20-16-5-2-4-13(11-16)10-14-7-8-15(12-17(14)19)18-6-3-9-21-18/h2-6,9-11,15H,7-8,12H2,1H3 |
| InChIKey | MHUMVNBQZHPCPX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|