C18H18F2N6O — CID 68644810
1-(5-amino-1,3-dihydroindazol-2-yl)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 68644810) has the molecular formula C18H18F2N6O and a molecular weight of 372.38 g/mol. Its IUPAC name is 1-(5-amino-1,3-dihydroindazol-2-yl)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-(5-amino-1,3-dihydroindazol-2-yl)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 68644810 |
| Molecular Formula | C18H18F2N6O |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-(5-amino-1,3-dihydroindazol-2-yl)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | CC(O)(c1ccc(F)cc1F)C(N1Cc2cc(N)ccc2N1)n1cncn1 |
| InChI | InChI=1S/C18H18F2N6O/c1-18(27,14-4-2-12(19)7-15(14)20)17(26-10-22-9-23-26)25-8-11-6-13(21)3-5-16(11)24-25/h2-7,9-10,17,24,27H,8,21H2,1H3 |
| InChIKey | LSESMZRBUJJHNE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|