C17H23F2N3O2 — CID 45137619
7-(2,4-difluorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)heptan-3-ol (PubChem CID 45137619) has the molecular formula C17H23F2N3O2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 7-(2,4-difluorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)heptan-3-ol.
| Compound Name | 7-(2,4-difluorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)heptan-3-ol |
|---|---|
| PubChem CID | 45137619 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 7-(2,4-difluorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)heptan-3-ol |
| SMILES | CC(C)(C)C(O)C(CCCOc1ccc(F)cc1F)n1cncn1 |
| InChI | InChI=1S/C17H23F2N3O2/c1-17(2,3)16(23)14(22-11-20-10-21-22)5-4-8-24-15-7-6-12(18)9-13(15)19/h6-7,9-11,14,16,23H,4-5,8H2,1-3H3 |
| InChIKey | KTUPFVZZSFYDAS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|