C17H23Cl2N3O2 — CID 67304076
8-(2,3-dichlorophenoxy)-2-methyl-4-(1,2,4-triazol-1-yl)octan-3-ol (PubChem CID 67304076) has the molecular formula C17H23Cl2N3O2 and a molecular weight of 372.30 g/mol. Its IUPAC name is 8-(2,3-dichlorophenoxy)-2-methyl-4-(1,2,4-triazol-1-yl)octan-3-ol.
| Compound Name | 8-(2,3-dichlorophenoxy)-2-methyl-4-(1,2,4-triazol-1-yl)octan-3-ol |
|---|---|
| PubChem CID | 67304076 |
| Molecular Formula | C17H23Cl2N3O2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 8-(2,3-dichlorophenoxy)-2-methyl-4-(1,2,4-triazol-1-yl)octan-3-ol |
| SMILES | CC(C)C(O)C(CCCCOc1cccc(Cl)c1Cl)n1cncn1 |
| InChI | InChI=1S/C17H23Cl2N3O2/c1-12(2)17(23)14(22-11-20-10-21-22)7-3-4-9-24-15-8-5-6-13(18)16(15)19/h5-6,8,10-12,14,17,23H,3-4,7,9H2,1-2H3 |
| InChIKey | BBHDIAWNHKAWOI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|