C18H23F2N3O2 — CID 68559450
6-(2,4-difluorophenoxy)-1-(1-methylcyclopropyl)-2-(1,2,4-triazol-1-yl)hexan-1-ol (PubChem CID 68559450) has the molecular formula C18H23F2N3O2 and a molecular weight of 351.40 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-1-(1-methylcyclopropyl)-2-(1,2,4-triazol-1-yl)hexan-1-ol.
| Compound Name | 6-(2,4-difluorophenoxy)-1-(1-methylcyclopropyl)-2-(1,2,4-triazol-1-yl)hexan-1-ol |
|---|---|
| PubChem CID | 68559450 |
| Molecular Formula | C18H23F2N3O2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-1-(1-methylcyclopropyl)-2-(1,2,4-triazol-1-yl)hexan-1-ol |
| SMILES | CC1(C(O)C(CCCCOc2ccc(F)cc2F)n2cncn2)CC1 |
| InChI | InChI=1S/C18H23F2N3O2/c1-18(7-8-18)17(24)15(23-12-21-11-22-23)4-2-3-9-25-16-6-5-13(19)10-14(16)20/h5-6,10-12,15,17,24H,2-4,7-9H2,1H3 |
| InChIKey | AAESOBCBOPTRGB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|