C9H11Cl2FN2O2 — CID 68646408
[2-amino-2-(3-chloro-2-fluorophenyl)ethyl] carbamate;hydrochloride (PubChem CID 68646408) has the molecular formula C9H11Cl2FN2O2 and a molecular weight of 269.10 g/mol. Its IUPAC name is [2-amino-2-(3-chloro-2-fluorophenyl)ethyl] carbamate;hydrochloride.
| Compound Name | [2-amino-2-(3-chloro-2-fluorophenyl)ethyl] carbamate;hydrochloride |
|---|---|
| PubChem CID | 68646408 |
| Molecular Formula | C9H11Cl2FN2O2 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | [2-amino-2-(3-chloro-2-fluorophenyl)ethyl] carbamate;hydrochloride |
| SMILES | Cl.NC(=O)OCC(N)c1cccc(Cl)c1F |
| InChI | InChI=1S/C9H10ClFN2O2.ClH/c10-6-3-1-2-5(8(6)11)7(12)4-15-9(13)14;/h1-3,7H,4,12H2,(H2,13,14);1H |
| InChIKey | LKTDMSZSINSXCR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |