C17H11BrF4N4OS — CID 68654677
3-bromo-4-fluoro-N'-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]benzohydrazide (PubChem CID 68654677) has the molecular formula C17H11BrF4N4OS and a molecular weight of 475.27 g/mol. Its IUPAC name is 3-bromo-4-fluoro-N'-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]benzohydrazide.
| Compound Name | 3-bromo-4-fluoro-N'-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]benzohydrazide |
|---|---|
| PubChem CID | 68654677 |
| Molecular Formula | C17H11BrF4N4OS |
| Molecular Weight | 475.27 g/mol |
| Exact Mass | 473.98 |
| IUPAC Name | 3-bromo-4-fluoro-N'-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]benzohydrazide |
| SMILES | O=C(NNc1nnc(Cc2ccc(C(F)(F)F)cc2)s1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C17H11BrF4N4OS/c18-12-8-10(3-6-13(12)19)15(27)24-26-16-25-23-14(28-16)7-9-1-4-11(5-2-9)17(20,21)22/h1-6,8H,7H2,(H,24,27)(H,25,26) |
| InChIKey | IHLYYJSOPFBYLW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|