C18H11F7N4OS — CID 87532913
5-fluoro-2-(trifluoromethyl)-N'-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]benzohydrazide (PubChem CID 87532913) has the molecular formula C18H11F7N4OS and a molecular weight of 464.37 g/mol. Its IUPAC name is 5-fluoro-2-(trifluoromethyl)-N'-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]benzohydrazide.
| Compound Name | 5-fluoro-2-(trifluoromethyl)-N'-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]benzohydrazide |
|---|---|
| PubChem CID | 87532913 |
| Molecular Formula | C18H11F7N4OS |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 5-fluoro-2-(trifluoromethyl)-N'-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]benzohydrazide |
| SMILES | O=C(NNc1nnc(Cc2ccc(C(F)(F)F)cc2)s1)c1cc(F)ccc1C(F)(F)F |
| InChI | InChI=1S/C18H11F7N4OS/c19-11-5-6-13(18(23,24)25)12(8-11)15(30)27-29-16-28-26-14(31-16)7-9-1-3-10(4-2-9)17(20,21)22/h1-6,8H,7H2,(H,27,30)(H,28,29) |
| InChIKey | WJSQTJVTKNGJMZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|