About 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine
3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine (PubChem CID 68672725) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine.
Analyze 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine?
The IUPAC name of 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine (CID 68672725) is 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine.
What is the SMILES notation for 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine?
The canonical SMILES for 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine is CCn1cnc2c1CCNCC2.
What is the InChIKey of 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine?
The InChIKey is VLFXOOPAPAFATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-2-12-7-11-8-3-5-10-6-4-9(8)12/h7,10H,2-6H2,1H3.
What are the key properties of 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine?
3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine has a molecular weight of 165.24 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,6,7,8-tetrahydro-4H-imidazo[4,5-d]azepine is sourced from PubChem (CID 68672725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).