C21H24N6O3S — CID 68673641
11-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-4-one (PubChem CID 68673641) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is 11-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-4-one.
| Compound Name | 11-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 68673641 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 11-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CC3=NC4NNC(=O)c5cccc(c54)N3)CC2)cc1 |
| InChI | InChI=1S/C21H24N6O3S/c1-14-5-7-15(8-6-14)31(29,30)27-11-9-26(10-12-27)13-18-22-17-4-2-3-16-19(17)20(23-18)24-25-21(16)28/h2-8,20,24H,9-13H2,1H3,(H,22,23)(H,25,28) |
| InChIKey | DZPMZYUVSXXOLN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |