C22H26N4O3S — CID 68676408
N'-[(2S)-1-hydroxy-4-methylpentan-2-yl]-3-oxo-5-(4-phenoxyanilino)-1,2-thiazole-4-carboximidamide (PubChem CID 68676408) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is N'-[(2S)-1-hydroxy-4-methylpentan-2-yl]-3-oxo-5-(4-phenoxyanilino)-1,2-thiazole-4-carboximidamide.
| Compound Name | N'-[(2S)-1-hydroxy-4-methylpentan-2-yl]-3-oxo-5-(4-phenoxyanilino)-1,2-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 68676408 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N'-[(2S)-1-hydroxy-4-methylpentan-2-yl]-3-oxo-5-(4-phenoxyanilino)-1,2-thiazole-4-carboximidamide |
| SMILES | CC(C)C[C@@H](CO)/N=C(\N)c1c(Nc2ccc(Oc3ccccc3)cc2)s[nH]c1=O |
| InChI | InChI=1S/C22H26N4O3S/c1-14(2)12-16(13-27)24-20(23)19-21(28)26-30-22(19)25-15-8-10-18(11-9-15)29-17-6-4-3-5-7-17/h3-11,14,16,25,27H,12-13H2,1-2H3,(H2,23,24)(H,26,28)/t16-/m0/s1 |
| InChIKey | YFQYVAQQIXVFBT-INIZCTEOSA-N |
| XLogP | 4.08 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|